C17H19N3O2 — CID 51173400
N-(1-cyanocyclohexyl)-2-(3-cyanophenoxy)-N-methylacetamide (PubChem CID 51173400) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-(3-cyanophenoxy)-N-methylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-(3-cyanophenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 51173400 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-(3-cyanophenoxy)-N-methylacetamide |
| SMILES | CN(C(=O)COc1cccc(C#N)c1)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H19N3O2/c1-20(17(13-19)8-3-2-4-9-17)16(21)12-22-15-7-5-6-14(10-15)11-18/h5-7,10H,2-4,8-9,12H2,1H3 |
| InChIKey | QSMRTJKDONSMFG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |