C16H18BrClN2O2 — CID 7382488
2-(4-bromo-2-chlorophenoxy)-N-(1-cyanocyclohexyl)-N-methylacetamide (PubChem CID 7382488) has the molecular formula C16H18BrClN2O2 and a molecular weight of 385.69 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-(1-cyanocyclohexyl)-N-methylacetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-(1-cyanocyclohexyl)-N-methylacetamide |
|---|---|
| PubChem CID | 7382488 |
| Molecular Formula | C16H18BrClN2O2 |
| Molecular Weight | 385.69 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-(1-cyanocyclohexyl)-N-methylacetamide |
| SMILES | CN(C(=O)COc1ccc(Br)cc1Cl)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C16H18BrClN2O2/c1-20(16(11-19)7-3-2-4-8-16)15(21)10-22-14-6-5-12(17)9-13(14)18/h5-6,9H,2-4,7-8,10H2,1H3 |
| InChIKey | JIWBUPRWOUIGKO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.69 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |