C20H25ClN2O5 — CID 7253937
[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate (PubChem CID 7253937) has the molecular formula C20H25ClN2O5 and a molecular weight of 408.88 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7253937 |
| Molecular Formula | C20H25ClN2O5 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)OCC(=O)N(C)C2(C#N)CCCCC2)cc1OC |
| InChI | InChI=1S/C20H25ClN2O5/c1-4-27-18-15(21)10-14(11-16(18)26-3)19(25)28-12-17(24)23(2)20(13-22)8-6-5-7-9-20/h10-11H,4-9,12H2,1-3H3 |
| InChIKey | PMBJAYXXZFVENT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |