C16H17Cl2N3O3 — CID 7351902
[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 7351902) has the molecular formula C16H17Cl2N3O3 and a molecular weight of 370.24 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7351902 |
| Molecular Formula | C16H17Cl2N3O3 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | CN(C(=O)COC(=O)c1nc(Cl)ccc1Cl)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C16H17Cl2N3O3/c1-21(16(10-19)7-3-2-4-8-16)13(22)9-24-15(23)14-11(17)5-6-12(18)20-14/h5-6H,2-4,7-9H2,1H3 |
| InChIKey | YJCGLRWOSGGTFB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|