C15H17N3O6 — CID 7754465
[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 7754465) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 7754465 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | CN(C(=O)COC(=O)c1ccc([N+](=O)[O-])o1)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C15H17N3O6/c1-17(15(10-16)7-3-2-4-8-15)12(19)9-23-14(20)11-5-6-13(24-11)18(21)22/h5-6H,2-4,7-9H2,1H3 |
| InChIKey | FHEGIHRDNVKHND-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 126.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|