C18H17N3O6 — CID 2619804
[2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2619804) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2619804 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 5-nitrofuran-2-carboxylate |
| SMILES | Cc1cc(C)cc(N(CCC#N)C(=O)COC(=O)c2ccc([N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C18H17N3O6/c1-12-8-13(2)10-14(9-12)20(7-3-6-19)16(22)11-26-18(23)15-4-5-17(27-15)21(24)25/h4-5,8-10H,3,7,11H2,1-2H3 |
| InChIKey | ZAFOZSFHHKXFJF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 126.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|