C17H19IN2O4 — CID 55313433
[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55313433) has the molecular formula C17H19IN2O4 and a molecular weight of 442.25 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55313433 |
| Molecular Formula | C17H19IN2O4 |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | CN(C(=O)COC(=O)/C=C/c1ccc(I)o1)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H19IN2O4/c1-20(17(12-19)9-3-2-4-10-17)15(21)11-23-16(22)8-6-13-5-7-14(18)24-13/h5-8H,2-4,9-11H2,1H3/b8-6+ |
| InChIKey | CVFQKOKQJZGRES-SOFGYWHQSA-N |
| XLogP | 3.13 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|