C22H23N3O3 — CID 6219634
[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 6219634) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 6219634 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | CN(C(=O)COC(=O)/C=C/c1ccc2ccccc2n1)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C22H23N3O3/c1-25(22(16-23)13-5-2-6-14-22)20(26)15-28-21(27)12-11-18-10-9-17-7-3-4-8-19(17)24-18/h3-4,7-12H,2,5-6,13-15H2,1H3/b12-11+ |
| InChIKey | MNJVZTUWODXXSC-VAWYXSNFSA-N |
| XLogP | 3.48 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|