C14H18F6 — CID 59042279
2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,2,3,4,4a,5,8,8a-octahydronaphthalene (PubChem CID 59042279) has the molecular formula C14H18F6 and a molecular weight of 300.29 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,2,3,4,4a,5,8,8a-octahydronaphthalene.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 59042279 |
| Molecular Formula | C14H18F6 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
| SMILES | CC(C1CCC2CC=CCC2C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H18F6/c1-12(13(15,16)17,14(18,19)20)11-7-6-9-4-2-3-5-10(9)8-11/h2-3,9-11H,4-8H2,1H3 |
| InChIKey | HMFHMMIYUJEHRI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|