C26H33BrN5O5P — CID 59042314
dimethylphosphanyl 2-[[2-(benzhydrylcarbamoylhydrazinylidene)-3-[(2-bromoacetyl)amino]hexanoyl]amino]acetate (PubChem CID 59042314) has the molecular formula C26H33BrN5O5P and a molecular weight of 606.46 g/mol. Its IUPAC name is dimethylphosphanyl 2-[[2-(benzhydrylcarbamoylhydrazinylidene)-3-[(2-bromoacetyl)amino]hexanoyl]amino]acetate.
| Compound Name | dimethylphosphanyl 2-[[2-(benzhydrylcarbamoylhydrazinylidene)-3-[(2-bromoacetyl)amino]hexanoyl]amino]acetate |
|---|---|
| PubChem CID | 59042314 |
| Molecular Formula | C26H33BrN5O5P |
| Molecular Weight | 606.46 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | dimethylphosphanyl 2-[[2-(benzhydrylcarbamoylhydrazinylidene)-3-[(2-bromoacetyl)amino]hexanoyl]amino]acetate |
| SMILES | CCCC(NC(=O)CBr)C(=NNC(=O)NC(c1ccccc1)c1ccccc1)C(=O)NCC(=O)OP(C)C |
| InChI | InChI=1S/C26H33BrN5O5P/c1-4-11-20(29-21(33)16-27)24(25(35)28-17-22(34)37-38(2)3)31-32-26(36)30-23(18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-10,12-15,20,23H,4,11,16-17H2,1-3H3,(H,28,35)(H,29,33)(H2,30,32,36) |
| InChIKey | ZCOQOWCLCMFNLP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 137.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|