C29H35N3O7 — CID 59043776
(3S)-3-[[(2S)-1-[(2S)-3-methyl-2-[[2-(2-phenylmethoxyphenyl)acetyl]amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 59043776) has the molecular formula C29H35N3O7 and a molecular weight of 537.61 g/mol. Its IUPAC name is (3S)-3-[[(2S)-1-[(2S)-3-methyl-2-[[2-(2-phenylmethoxyphenyl)acetyl]amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-1-[(2S)-3-methyl-2-[[2-(2-phenylmethoxyphenyl)acetyl]amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59043776 |
| Molecular Formula | C29H35N3O7 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | (3S)-3-[[(2S)-1-[(2S)-3-methyl-2-[[2-(2-phenylmethoxyphenyl)acetyl]amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)Cc1ccccc1OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C29H35N3O7/c1-19(2)27(29(38)32-14-8-12-23(32)28(37)30-22(17-33)16-26(35)36)31-25(34)15-21-11-6-7-13-24(21)39-18-20-9-4-3-5-10-20/h3-7,9-11,13,17,19,22-23,27H,8,12,14-16,18H2,1-2H3,(H,30,37)(H,31,34)(H,35,36)/t22-,23-,27-/m0/s1 |
| InChIKey | KWLAIAVOLNLXAW-WCYRKSIYSA-N |
| XLogP | 2.10 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|