C26H35N3O6 — CID 89206441
3-[[1-[(2S)-3-methyl-2-[(3-phenylcyclopentanecarbonyl)amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 89206441) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-[[1-[(2S)-3-methyl-2-[(3-phenylcyclopentanecarbonyl)amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[1-[(2S)-3-methyl-2-[(3-phenylcyclopentanecarbonyl)amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89206441 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 3-[[1-[(2S)-3-methyl-2-[(3-phenylcyclopentanecarbonyl)amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C1CCC(c2ccccc2)C1)C(=O)N1CCCC1C(=O)NC(C=O)CC(=O)O |
| InChI | InChI=1S/C26H35N3O6/c1-16(2)23(28-24(33)19-11-10-18(13-19)17-7-4-3-5-8-17)26(35)29-12-6-9-21(29)25(34)27-20(15-30)14-22(31)32/h3-5,7-8,15-16,18-21,23H,6,9-14H2,1-2H3,(H,27,34)(H,28,33)(H,31,32)/t18?,19?,20?,21?,23-/m0/s1 |
| InChIKey | LTYYJGYLYFMCMF-LUKFGJPWSA-N |
| XLogP | 1.86 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|