C12H22O2 — CID 59045631
5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one (PubChem CID 59045631) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one.
| Compound Name | 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one |
|---|---|
| PubChem CID | 59045631 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one |
| SMILES | CC(=O)C(C)CC[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H22O2/c1-9(10(2)13)7-8-11-5-3-4-6-12(11)14/h9,11-12,14H,3-8H2,1-2H3/t9?,11-,12-/m0/s1 |
| InChIKey | CDESJDSUJSDZSP-WEBCLNCGSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |