About 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one
5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one (PubChem CID 59045631) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one.
Molecular Properties
| Compound Name | 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one |
| PubChem CID | 59045631 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one |
| SMILES | CC(=O)C(C)CC[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H22O2/c1-9(10(2)13)7-8-11-5-3-4-6-12(11)14/h9,11-12,14H,3-8H2,1-2H3/t9?,11-,12-/m0/s1 |
| InChIKey | CDESJDSUJSDZSP-WEBCLNCGSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one?
The IUPAC name of 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one (CID 59045631) is 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one.
What is the SMILES notation for 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one?
The canonical SMILES for 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one is CC(=O)C(C)CC[C@@H]1CCCC[C@@H]1O.
What is the InChIKey of 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one?
The InChIKey is CDESJDSUJSDZSP-WEBCLNCGSA-N. The full InChI is InChI=1S/C12H22O2/c1-9(10(2)13)7-8-11-5-3-4-6-12(11)14/h9,11-12,14H,3-8H2,1-2H3/t9?,11-,12-/m0/s1.
What are the key properties of 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one?
5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one has a molecular weight of 198.31 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S,2S)-2-hydroxycyclohexyl]-3-methylpentan-2-one is sourced from PubChem (CID 59045631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).