C19H24ClNO4 — CID 59046182
4-[(1R)-2-[(3-chloro-4-methoxyphenyl)methyl-propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol (PubChem CID 59046182) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is 4-[(1R)-2-[(3-chloro-4-methoxyphenyl)methyl-propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol.
| Compound Name | 4-[(1R)-2-[(3-chloro-4-methoxyphenyl)methyl-propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 59046182 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[(1R)-2-[(3-chloro-4-methoxyphenyl)methyl-propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol |
| SMILES | COc1ccc(CN(C[C@H](O)c2ccc(O)c(O)c2)C(C)C)cc1Cl |
| InChI | InChI=1S/C19H24ClNO4/c1-12(2)21(10-13-4-7-19(25-3)15(20)8-13)11-18(24)14-5-6-16(22)17(23)9-14/h4-9,12,18,22-24H,10-11H2,1-3H3/t18-/m0/s1 |
| InChIKey | NHFUFMFHBRZQFK-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|