C26H16O3 — CID 59046859
methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate (PubChem CID 59046859) has the molecular formula C26H16O3 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate.
| Compound Name | methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate |
|---|---|
| PubChem CID | 59046859 |
| Molecular Formula | C26H16O3 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate |
| SMILES | C#CC#CC#COc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H16O3/c1-3-4-5-6-19-29-25-17-15-23(16-18-25)21-9-7-20(8-10-21)22-11-13-24(14-12-22)26(27)28-2/h1,7-18H,2H3 |
| InChIKey | OHRKISAGTWRHLD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|