methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate

C26H16O3 — CID 59046859

IUPACmethyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate
SMILESC#CC#CC#COc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)cc2)cc1
InChIInChI=1S/C26H16O3/c1-3-4-5-6-19-29-25-17-15-23(16-18-25)21-9-7-20(8-10-21)22-11-13-24(14-12-22)26(27)28-2/h1,7-18H,2H3
InChIKeyOHRKISAGTWRHLD-UHFFFAOYSA-N
MW376.41 g/mol
LogP4.78
Rot. Bonds4

About methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate

methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate (PubChem CID 59046859) has the molecular formula C26H16O3 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate
PubChem CID59046859
Molecular FormulaC26H16O3
Molecular Weight376.41 g/mol
Exact Mass376.11
IUPAC Namemethyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate
SMILESC#CC#CC#COc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)cc2)cc1
InChIInChI=1S/C26H16O3/c1-3-4-5-6-19-29-25-17-15-23(16-18-25)21-9-7-20(8-10-21)22-11-13-24(14-12-22)26(27)28-2/h1,7-18H,2H3
InChIKeyOHRKISAGTWRHLD-UHFFFAOYSA-N
XLogP4.78
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500376.41
LogP ≤ 54.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate?
The IUPAC name of methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate (CID 59046859) is methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate.
What is the SMILES notation for methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate?
The canonical SMILES for methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate is C#CC#CC#COc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)cc2)cc1.
What is the InChIKey of methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate?
The InChIKey is OHRKISAGTWRHLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16O3/c1-3-4-5-6-19-29-25-17-15-23(16-18-25)21-9-7-20(8-10-21)22-11-13-24(14-12-22)26(27)28-2/h1,7-18H,2H3.
What are the key properties of methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate?
methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate has a molecular weight of 376.41 g/mol, XLogP of 4.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(4-hexa-1,3,5-triynoxyphenyl)phenyl]benzoate is sourced from PubChem (CID 59046859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).