C16H8O3 — CID 58627149
methyl 4-octa-1,3,5,7-tetraynoxybenzoate (PubChem CID 58627149) has the molecular formula C16H8O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is methyl 4-octa-1,3,5,7-tetraynoxybenzoate.
| Compound Name | methyl 4-octa-1,3,5,7-tetraynoxybenzoate |
|---|---|
| PubChem CID | 58627149 |
| Molecular Formula | C16H8O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | methyl 4-octa-1,3,5,7-tetraynoxybenzoate |
| SMILES | C#CC#CC#CC#COc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C16H8O3/c1-3-4-5-6-7-8-13-19-15-11-9-14(10-12-15)16(17)18-2/h1,9-12H,2H3 |
| InChIKey | LYVJVHRNCJTQAK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|