C74H8O5 — CID 118490166
methyl 3,4,5-tris(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynoxy)benzoate (PubChem CID 118490166) has the molecular formula C74H8O5 and a molecular weight of 976.87 g/mol. Its IUPAC name is methyl 3,4,5-tris(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynoxy)benzoate.
| Compound Name | methyl 3,4,5-tris(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynoxy)benzoate |
|---|---|
| PubChem CID | 118490166 |
| Molecular Formula | C74H8O5 |
| Molecular Weight | 976.87 g/mol |
| Exact Mass | 976.04 |
| IUPAC Name | methyl 3,4,5-tris(docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynoxy)benzoate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#COc1cc(C(=O)OC)cc(OC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#C)c1OC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#C |
| InChI | InChI=1S/C74H8O5/c1-5-8-11-14-17-20-23-26-29-32-35-38-41-44-47-50-53-56-59-62-65-77-71-68-70(74(75)76-4)69-72(78-66-63-60-57-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-2)73(71)79-67-64-61-58-55-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-3/h1-3,68-69H,4H3 |
| InChIKey | GIDDLLNGPCXTEM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 79 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.87 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|