C13H19FN4O — CID 59047031
[(7R)-2-(5-fluoropyrimidin-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol (PubChem CID 59047031) has the molecular formula C13H19FN4O and a molecular weight of 266.32 g/mol. Its IUPAC name is [(7R)-2-(5-fluoropyrimidin-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol.
| Compound Name | [(7R)-2-(5-fluoropyrimidin-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol |
|---|---|
| PubChem CID | 59047031 |
| Molecular Formula | C13H19FN4O |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(7R)-2-(5-fluoropyrimidin-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol |
| SMILES | OC[C@@H]1CCC2CN(c3ncc(F)cn3)CCN2C1 |
| InChI | InChI=1S/C13H19FN4O/c14-11-5-15-13(16-6-11)18-4-3-17-7-10(9-19)1-2-12(17)8-18/h5-6,10,12,19H,1-4,7-9H2/t10-,12?/m1/s1 |
| InChIKey | XRKCPDJKDFJNRF-RWANSRKNSA-N |
| XLogP | 0.51 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |