C17H27N2O14P2S- — CID 59047282
[(2S,4R,5R)-3,4-dihydroxy-6-(hydroxymethyl)-5-sulfanyloxan-2-yl] [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-(5-methyl-2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] phosphate (PubChem CID 59047282) has the molecular formula C17H27N2O14P2S- and a molecular weight of 577.42 g/mol. Its IUPAC name is [(2S,4R,5R)-3,4-dihydroxy-6-(hydroxymethyl)-5-sulfanyloxan-2-yl] [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-(5-methyl-2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] phosphate.
| Compound Name | [(2S,4R,5R)-3,4-dihydroxy-6-(hydroxymethyl)-5-sulfanyloxan-2-yl] [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-(5-methyl-2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] phosphate |
|---|---|
| PubChem CID | 59047282 |
| Molecular Formula | C17H27N2O14P2S- |
| Molecular Weight | 577.42 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | [(2S,4R,5R)-3,4-dihydroxy-6-(hydroxymethyl)-5-sulfanyloxan-2-yl] [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-(5-methyl-2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] phosphate |
| SMILES | C=C1NC(=O)C(C)=CN1[C@H]1C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)([O-])O[C@@H]2OC(CO)[C@H](S)[C@H](O)C2O)O1 |
| InChI | InChI=1S/C17H28N2O14P2S/c1-7-4-19(8(2)18-16(7)24)12-3-9(21)11(30-12)6-29-34(25,26)33-35(27,28)32-17-14(23)13(22)15(36)10(5-20)31-17/h4,9-15,17,20-23,36H,2-3,5-6H2,1H3,(H,18,24)(H,25,26)(H,27,28)/p-1/t9-,10?,11-,12-,13-,14?,15+,17+/m1/s1 |
| InChIKey | LMLCADGFMAEAEN-MNEHNLEOSA-M |
| XLogP | -2.37 |
| TPSA | 236.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.42 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|