C20H29N2O14P3 — CID 59189521
[[(2R,3R,5R)-5-[5-[(2,6-dimethylphenyl)methoxymethyl]-2-methylidene-4-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 59189521) has the molecular formula C20H29N2O14P3 and a molecular weight of 614.37 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[5-[(2,6-dimethylphenyl)methoxymethyl]-2-methylidene-4-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-[5-[(2,6-dimethylphenyl)methoxymethyl]-2-methylidene-4-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 59189521 |
| Molecular Formula | C20H29N2O14P3 |
| Molecular Weight | 614.37 g/mol |
| Exact Mass | 614.08 |
| IUPAC Name | [[(2R,3R,5R)-5-[5-[(2,6-dimethylphenyl)methoxymethyl]-2-methylidene-4-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C1NC(=O)C(COCc2c(C)cccc2C)=CN1[C@H]1C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C20H29N2O14P3/c1-12-5-4-6-13(2)16(12)10-32-9-15-8-22(14(3)21-20(15)24)19-7-17(23)18(34-19)11-33-38(28,29)36-39(30,31)35-37(25,26)27/h4-6,8,17-19,23H,3,7,9-11H2,1-2H3,(H,21,24)(H,28,29)(H,30,31)(H2,25,26,27)/t17-,18-,19-/m1/s1 |
| InChIKey | CCDSHULKPRBEFA-GUDVDZBRSA-N |
| XLogP | 1.43 |
| TPSA | 230.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|