C20H28NO15P3 — CID 158319166
[[(2R,3R,5R)-5-[5-[(2,6-dimethylphenyl)methoxymethyl]-2,4-dioxo-1-pyridinyl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 158319166) has the molecular formula C20H28NO15P3 and a molecular weight of 615.36 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-[5-[(2,6-dimethylphenyl)methoxymethyl]-2,4-dioxo-1-pyridinyl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-[5-[(2,6-dimethylphenyl)methoxymethyl]-2,4-dioxo-1-pyridinyl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 158319166 |
| Molecular Formula | C20H28NO15P3 |
| Molecular Weight | 615.36 g/mol |
| Exact Mass | 615.07 |
| IUPAC Name | [[(2R,3R,5R)-5-[5-[(2,6-dimethylphenyl)methoxymethyl]-2,4-dioxo-1-pyridinyl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cccc(C)c1COCC1=CN([C@H]2C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C(=O)CC1=O |
| InChI | InChI=1S/C20H28NO15P3/c1-12-4-3-5-13(2)15(12)10-32-9-14-8-21(19(24)6-16(14)22)20-7-17(23)18(34-20)11-33-38(28,29)36-39(30,31)35-37(25,26)27/h3-5,8,17-18,20,23H,6-7,9-11H2,1-2H3,(H,28,29)(H,30,31)(H2,25,26,27)/t17-,18-,20-/m1/s1 |
| InChIKey | XJSSUWADZMIROM-QWFCFKBJSA-N |
| XLogP | 1.32 |
| TPSA | 235.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|