C22H27N3O6 — CID 59052221
(2R,3R,4S,5R,6S)-4-[[2-(azidomethyl)phenyl]methoxy]-2-(hydroxymethyl)-6-methoxy-5-phenylmethoxyoxan-3-ol (PubChem CID 59052221) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-4-[[2-(azidomethyl)phenyl]methoxy]-2-(hydroxymethyl)-6-methoxy-5-phenylmethoxyoxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-4-[[2-(azidomethyl)phenyl]methoxy]-2-(hydroxymethyl)-6-methoxy-5-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 59052221 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (2R,3R,4S,5R,6S)-4-[[2-(azidomethyl)phenyl]methoxy]-2-(hydroxymethyl)-6-methoxy-5-phenylmethoxyoxan-3-ol |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](OCc2ccccc2CN=[N+]=[N-])[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H27N3O6/c1-28-22-21(29-13-15-7-3-2-4-8-15)20(19(27)18(12-26)31-22)30-14-17-10-6-5-9-16(17)11-24-25-23/h2-10,18-22,26-27H,11-14H2,1H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | AVAFGMYQUBIXGF-BDHVOXNPSA-N |
| XLogP | 2.69 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|