C19H13NOS3 — CID 59052600
1,3-benzothiazol-2-yl 4-methoxynaphthalene-1-carbodithioate (PubChem CID 59052600) has the molecular formula C19H13NOS3 and a molecular weight of 367.52 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl 4-methoxynaphthalene-1-carbodithioate.
| Compound Name | 1,3-benzothiazol-2-yl 4-methoxynaphthalene-1-carbodithioate |
|---|---|
| PubChem CID | 59052600 |
| Molecular Formula | C19H13NOS3 |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 1,3-benzothiazol-2-yl 4-methoxynaphthalene-1-carbodithioate |
| SMILES | COc1ccc(C(=S)Sc2nc3ccccc3s2)c2ccccc12 |
| InChI | InChI=1S/C19H13NOS3/c1-21-16-11-10-14(12-6-2-3-7-13(12)16)18(22)24-19-20-15-8-4-5-9-17(15)23-19/h2-11H,1H3 |
| InChIKey | JXUIPZLWMVCNIS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|