C18H21NO3S — CID 59052603
5-[(4-ethoxynaphthalene-1-carbothioyl)amino]pentanoic acid (PubChem CID 59052603) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 5-[(4-ethoxynaphthalene-1-carbothioyl)amino]pentanoic acid.
| Compound Name | 5-[(4-ethoxynaphthalene-1-carbothioyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 59052603 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-[(4-ethoxynaphthalene-1-carbothioyl)amino]pentanoic acid |
| SMILES | CCOc1ccc(C(=S)NCCCCC(=O)O)c2ccccc12 |
| InChI | InChI=1S/C18H21NO3S/c1-2-22-16-11-10-15(13-7-3-4-8-14(13)16)18(23)19-12-6-5-9-17(20)21/h3-4,7-8,10-11H,2,5-6,9,12H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | MORAOCQROVDIEL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|