C22H28N2O6S — CID 59053242
(1S,4R,6S,9R)-4-methyl-13-(2-nitrophenyl)sulfonyl-13-azatricyclo[7.7.0.01,6]hexadecane-2,8-dione (PubChem CID 59053242) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is (1S,4R,6S,9R)-4-methyl-13-(2-nitrophenyl)sulfonyl-13-azatricyclo[7.7.0.01,6]hexadecane-2,8-dione.
| Compound Name | (1S,4R,6S,9R)-4-methyl-13-(2-nitrophenyl)sulfonyl-13-azatricyclo[7.7.0.01,6]hexadecane-2,8-dione |
|---|---|
| PubChem CID | 59053242 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (1S,4R,6S,9R)-4-methyl-13-(2-nitrophenyl)sulfonyl-13-azatricyclo[7.7.0.01,6]hexadecane-2,8-dione |
| SMILES | C[C@H]1CC(=O)[C@]23CCCN(S(=O)(=O)c4ccccc4[N+](=O)[O-])CCC[C@H]2C(=O)C[C@@H]3C1 |
| InChI | InChI=1S/C22H28N2O6S/c1-15-12-16-14-19(25)17-6-4-10-23(11-5-9-22(16,17)21(26)13-15)31(29,30)20-8-3-2-7-18(20)24(27)28/h2-3,7-8,15-17H,4-6,9-14H2,1H3/t15-,16+,17+,22+/m1/s1 |
| InChIKey | ZDDDYJINFKBUGY-VLMPBXDWSA-N |
| XLogP | 3.35 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|