C24H21Cl3N6O — CID 59053513
5-(3-chloro-4-piperazin-1-ylanilino)-7-[(2,6-dichlorophenyl)methyl]-3H-pyrido[3,4-d]pyridazin-4-one (PubChem CID 59053513) has the molecular formula C24H21Cl3N6O and a molecular weight of 515.83 g/mol. Its IUPAC name is 5-(3-chloro-4-piperazin-1-ylanilino)-7-[(2,6-dichlorophenyl)methyl]-3H-pyrido[3,4-d]pyridazin-4-one.
| Compound Name | 5-(3-chloro-4-piperazin-1-ylanilino)-7-[(2,6-dichlorophenyl)methyl]-3H-pyrido[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 59053513 |
| Molecular Formula | C24H21Cl3N6O |
| Molecular Weight | 515.83 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 5-(3-chloro-4-piperazin-1-ylanilino)-7-[(2,6-dichlorophenyl)methyl]-3H-pyrido[3,4-d]pyridazin-4-one |
| SMILES | O=c1[nH]ncc2cc(Cc3c(Cl)cccc3Cl)nc(Nc3ccc(N4CCNCC4)c(Cl)c3)c12 |
| InChI | InChI=1S/C24H21Cl3N6O/c25-18-2-1-3-19(26)17(18)11-16-10-14-13-29-32-24(34)22(14)23(31-16)30-15-4-5-21(20(27)12-15)33-8-6-28-7-9-33/h1-5,10,12-13,28H,6-9,11H2,(H,30,31)(H,32,34) |
| InChIKey | JNWQPEKQSANDPZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|