C24H22Cl2FN7O2 — CID 59053450
7-(2,3-dichloro-4-fluoroanilino)-5-(2-methoxy-4-piperazin-1-ylanilino)-3H-pyrido[3,4-d]pyridazin-4-one (PubChem CID 59053450) has the molecular formula C24H22Cl2FN7O2 and a molecular weight of 530.39 g/mol. Its IUPAC name is 7-(2,3-dichloro-4-fluoroanilino)-5-(2-methoxy-4-piperazin-1-ylanilino)-3H-pyrido[3,4-d]pyridazin-4-one.
| Compound Name | 7-(2,3-dichloro-4-fluoroanilino)-5-(2-methoxy-4-piperazin-1-ylanilino)-3H-pyrido[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 59053450 |
| Molecular Formula | C24H22Cl2FN7O2 |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 7-(2,3-dichloro-4-fluoroanilino)-5-(2-methoxy-4-piperazin-1-ylanilino)-3H-pyrido[3,4-d]pyridazin-4-one |
| SMILES | COc1cc(N2CCNCC2)ccc1Nc1nc(Nc2ccc(F)c(Cl)c2Cl)cc2cn[nH]c(=O)c12 |
| InChI | InChI=1S/C24H22Cl2FN7O2/c1-36-18-11-14(34-8-6-28-7-9-34)2-4-16(18)31-23-20-13(12-29-33-24(20)35)10-19(32-23)30-17-5-3-15(27)21(25)22(17)26/h2-5,10-12,28H,6-9H2,1H3,(H,33,35)(H2,30,31,32) |
| InChIKey | AOIWFIPRRQYDJD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|