C14H11ClN4O2 — CID 88756925
7-chloro-5-(2-methoxyanilino)-3H-pyrido[3,4-d]pyridazin-4-one (PubChem CID 88756925) has the molecular formula C14H11ClN4O2 and a molecular weight of 302.72 g/mol. Its IUPAC name is 7-chloro-5-(2-methoxyanilino)-3H-pyrido[3,4-d]pyridazin-4-one.
| Compound Name | 7-chloro-5-(2-methoxyanilino)-3H-pyrido[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 88756925 |
| Molecular Formula | C14H11ClN4O2 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 7-chloro-5-(2-methoxyanilino)-3H-pyrido[3,4-d]pyridazin-4-one |
| SMILES | COc1ccccc1Nc1nc(Cl)cc2cn[nH]c(=O)c12 |
| InChI | InChI=1S/C14H11ClN4O2/c1-21-10-5-3-2-4-9(10)17-13-12-8(6-11(15)18-13)7-16-19-14(12)20/h2-7H,1H3,(H,17,18)(H,19,20) |
| InChIKey | HOSYPEFINYSHEF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|