C21H23ClN6O2 — CID 88757197
5-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyanilino]-7-chloro-3H-pyrido[3,4-d]pyridazin-4-one (PubChem CID 88757197) has the molecular formula C21H23ClN6O2 and a molecular weight of 426.91 g/mol. Its IUPAC name is 5-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyanilino]-7-chloro-3H-pyrido[3,4-d]pyridazin-4-one.
| Compound Name | 5-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyanilino]-7-chloro-3H-pyrido[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 88757197 |
| Molecular Formula | C21H23ClN6O2 |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 5-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-methoxyanilino]-7-chloro-3H-pyrido[3,4-d]pyridazin-4-one |
| SMILES | COc1cc(N2CCN3CCCC3C2)ccc1Nc1nc(Cl)cc2cn[nH]c(=O)c12 |
| InChI | InChI=1S/C21H23ClN6O2/c1-30-17-10-14(28-8-7-27-6-2-3-15(27)12-28)4-5-16(17)24-20-19-13(9-18(22)25-20)11-23-26-21(19)29/h4-5,9-11,15H,2-3,6-8,12H2,1H3,(H,24,25)(H,26,29) |
| InChIKey | BBYVDRVSNWCJIS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|