C19H21ClN6O2 — CID 90187849
7-chloro-5-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-3H-pyrido[3,4-d]pyridazin-4-one (PubChem CID 90187849) has the molecular formula C19H21ClN6O2 and a molecular weight of 400.87 g/mol. Its IUPAC name is 7-chloro-5-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-3H-pyrido[3,4-d]pyridazin-4-one.
| Compound Name | 7-chloro-5-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-3H-pyrido[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 90187849 |
| Molecular Formula | C19H21ClN6O2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 7-chloro-5-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-3H-pyrido[3,4-d]pyridazin-4-one |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1nc(Cl)cc2cn[nH]c(=O)c12 |
| InChI | InChI=1S/C19H21ClN6O2/c1-25-5-7-26(8-6-25)13-3-4-14(15(10-13)28-2)22-18-17-12(9-16(20)23-18)11-21-24-19(17)27/h3-4,9-11H,5-8H2,1-2H3,(H,22,23)(H,24,27) |
| InChIKey | BEHRDTLXWKZIKJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|