C16H27ClN2O2S2 — CID 59058378
4-chloro-5-(1-hydroxypiperidin-2-yl)sulfanyl-2-octyl-1,2-thiazol-3-one (PubChem CID 59058378) has the molecular formula C16H27ClN2O2S2 and a molecular weight of 378.99 g/mol. Its IUPAC name is 4-chloro-5-(1-hydroxypiperidin-2-yl)sulfanyl-2-octyl-1,2-thiazol-3-one.
| Compound Name | 4-chloro-5-(1-hydroxypiperidin-2-yl)sulfanyl-2-octyl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 59058378 |
| Molecular Formula | C16H27ClN2O2S2 |
| Molecular Weight | 378.99 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-chloro-5-(1-hydroxypiperidin-2-yl)sulfanyl-2-octyl-1,2-thiazol-3-one |
| SMILES | CCCCCCCCn1sc(SC2CCCCN2O)c(Cl)c1=O |
| InChI | InChI=1S/C16H27ClN2O2S2/c1-2-3-4-5-6-8-12-19-15(20)14(17)16(23-19)22-13-10-7-9-11-18(13)21/h13,21H,2-12H2,1H3 |
| InChIKey | JKEBBWNKOXWNHY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.99 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|