C29H46AcBO4S — CID 59058750
CID 59058750 (PubChem CID 59058750) has the molecular formula C29H46AcBO4S and a molecular weight of 730.57 g/mol.
| Compound Name | CID 59058750 |
|---|---|
| PubChem CID | 59058750 |
| Molecular Formula | C29H46AcBO4S |
| Molecular Weight | 730.57 g/mol |
| Exact Mass | 730.36 |
| IUPAC Name | — |
| SMILES | [3H][B]SO[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C([C@H](C)C4(CCC(C)C)OCCO4)=C(O)C[C@@H]32)C1.[Ac] |
| InChI | InChI=1S/C29H46BO4S.Ac/c1-18(2)8-13-29(32-14-15-33-29)19(3)26-25(31)17-24-22-7-6-20-16-21(34-35-30)9-11-27(20,4)23(22)10-12-28(24,26)5;/h6,18-19,21-24,30-31H,7-17H2,1-5H3;/t19-,21-,22+,23-,24-,27-,28-;/m0./s1/i30T; |
| InChIKey | DPNZHYCHGQIVCI-ZRMLAWHASA-N |
| XLogP | 7.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.57 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|