C21H30BO2S — CID 59058734
CID 59058734 (PubChem CID 59058734) has the molecular formula C21H30BO2S and a molecular weight of 359.36 g/mol.
| Compound Name | CID 59058734 |
|---|---|
| PubChem CID | 59058734 |
| Molecular Formula | C21H30BO2S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | — |
| SMILES | [3H][B]SO[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)/C(=C\C)C(=O)C[C@@H]32)C1 |
| InChI | InChI=1S/C21H30BO2S/c1-4-16-19(23)12-18-15-6-5-13-11-14(24-25-22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4-5,14-15,17-18,22H,6-12H2,1-3H3/b16-4-/t14-,15+,17-,18-,20-,21+/m0/s1/i22T |
| InChIKey | HGLQJRKMHXAZKO-CRVAKCEKSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|