C10H17O2- — CID 59059766
2-[(1S,3R)-1-ethyl-3-methylcyclopentyl]acetate (PubChem CID 59059766) has the molecular formula C10H17O2- and a molecular weight of 169.24 g/mol. Its IUPAC name is 2-[(1S,3R)-1-ethyl-3-methylcyclopentyl]acetate.
| Compound Name | 2-[(1S,3R)-1-ethyl-3-methylcyclopentyl]acetate |
|---|---|
| PubChem CID | 59059766 |
| Molecular Formula | C10H17O2- |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 2-[(1S,3R)-1-ethyl-3-methylcyclopentyl]acetate |
| SMILES | CC[C@]1(CC(=O)[O-])CC[C@@H](C)C1 |
| InChI | InChI=1S/C10H18O2/c1-3-10(7-9(11)12)5-4-8(2)6-10/h8H,3-7H2,1-2H3,(H,11,12)/p-1/t8-,10+/m1/s1 |
| InChIKey | IIGQIXBIWKSBKO-SCZZXKLOSA-M |
| XLogP | 1.34 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |