C7H13NO — CID 59062482
(2S,4E)-4-ethylidene-2-(tritiooxymethyl)pyrrolidine (PubChem CID 59062482) has the molecular formula C7H13NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (2S,4E)-4-ethylidene-2-(tritiooxymethyl)pyrrolidine.
| Compound Name | (2S,4E)-4-ethylidene-2-(tritiooxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 59062482 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.11 |
| IUPAC Name | (2S,4E)-4-ethylidene-2-(tritiooxymethyl)pyrrolidine |
| SMILES | [3H]OC[C@@H]1C/C(=C\C)CN1 |
| InChI | InChI=1S/C7H13NO/c1-2-6-3-7(5-9)8-4-6/h2,7-9H,3-5H2,1H3/b6-2+/t7-/m0/s1/i9T |
| InChIKey | CDKRFXATEMXGMH-QWVZDQTESA-N |
| XLogP | 0.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|