About iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)
iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) (PubChem CID 59063314) has the molecular formula C20H36IrN4-4
and a molecular weight of 524.75 g/mol. Its IUPAC name is iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide).
Molecular Properties
| Compound Name | iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) |
| PubChem CID | 59063314 |
| Molecular Formula | C20H36IrN4-4 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) |
| SMILES | C1CCC(C2CCCC[N-]2)[N-]C1.C1CCC(C2CCCC[N-]2)[N-]C1.[Ir] |
| InChI | InChI=1S/2C10H18N2.Ir/c2*1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h2*9-10H,1-8H2;/q2*-2; |
| InChIKey | DPMZBOYSDLPUFJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)?
The IUPAC name of iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) (CID 59063314) is iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide).
What is the SMILES notation for iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)?
The canonical SMILES for iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) is C1CCC(C2CCCC[N-]2)[N-]C1.C1CCC(C2CCCC[N-]2)[N-]C1.[Ir].
What is the InChIKey of iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)?
The InChIKey is DPMZBOYSDLPUFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H18N2.Ir/c2*1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h2*9-10H,1-8H2;/q2*-2;.
What are the key properties of iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)?
iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) has a molecular weight of 524.75 g/mol, XLogP of 5.68, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) is sourced from PubChem (CID 59063314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).