C27H38N4O3SSi — CID 59063644
N-[5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]ethyl]-2-pyridinyl]acetamide (PubChem CID 59063644) has the molecular formula C27H38N4O3SSi and a molecular weight of 526.78 g/mol. Its IUPAC name is N-[5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]ethyl]-2-pyridinyl]acetamide.
| Compound Name | N-[5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]ethyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 59063644 |
| Molecular Formula | C27H38N4O3SSi |
| Molecular Weight | 526.78 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | N-[5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]ethyl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc([C@@H](CNCCOc2ccc(-c3csc(C)n3)cc2)O[Si](C)(C)C(C)(C)C)cn1 |
| InChI | InChI=1S/C27H38N4O3SSi/c1-19(32)30-26-13-10-22(16-29-26)25(34-36(6,7)27(3,4)5)17-28-14-15-33-23-11-8-21(9-12-23)24-18-35-20(2)31-24/h8-13,16,18,25,28H,14-15,17H2,1-7H3,(H,29,30,32)/t25-/m1/s1 |
| InChIKey | ZXZPLYGTYWRFPC-RUZDIDTESA-N |
| XLogP | 6.20 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.78 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|