C30H32N3O4PS — CID 59064646
methyl 2-diphenylphosphanyl-4-[5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]benzoate (PubChem CID 59064646) has the molecular formula C30H32N3O4PS and a molecular weight of 561.64 g/mol. Its IUPAC name is methyl 2-diphenylphosphanyl-4-[5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]benzoate.
| Compound Name | methyl 2-diphenylphosphanyl-4-[5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]benzoate |
|---|---|
| PubChem CID | 59064646 |
| Molecular Formula | C30H32N3O4PS |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | methyl 2-diphenylphosphanyl-4-[5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CCCC[C@H]2SCC3NC(=O)NC32)cc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32N3O4PS/c1-37-29(35)23-17-16-20(18-25(23)38(21-10-4-2-5-11-21)22-12-6-3-7-13-22)31-27(34)15-9-8-14-26-28-24(19-39-26)32-30(36)33-28/h2-7,10-13,16-18,24,26,28H,8-9,14-15,19H2,1H3,(H,31,34)(H2,32,33,36)/t24?,26-,28?/m1/s1 |
| InChIKey | NAMJUSQCIDDRPZ-ZXZCYCBTSA-N |
| XLogP | 3.90 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|