C27H20F3NO2S — CID 59066191
ethyl 3-(1-benzothiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate (PubChem CID 59066191) has the molecular formula C27H20F3NO2S and a molecular weight of 479.52 g/mol. Its IUPAC name is ethyl 3-(1-benzothiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate.
| Compound Name | ethyl 3-(1-benzothiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 59066191 |
| Molecular Formula | C27H20F3NO2S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | ethyl 3-(1-benzothiophen-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cc3ccccc3s2)c2ccccc2n1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H20F3NO2S/c1-2-33-26(32)25-24(23-15-18-9-3-6-13-22(18)34-23)20-11-4-5-12-21(20)31(25)16-17-8-7-10-19(14-17)27(28,29)30/h3-15H,2,16H2,1H3 |
| InChIKey | ZJVRRTSQQQAMCK-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |