C25H39NO6 — CID 59067308
3-nitro-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]hexanedioic acid (PubChem CID 59067308) has the molecular formula C25H39NO6 and a molecular weight of 449.59 g/mol. Its IUPAC name is 3-nitro-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]hexanedioic acid.
| Compound Name | 3-nitro-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]hexanedioic acid |
|---|---|
| PubChem CID | 59067308 |
| Molecular Formula | C25H39NO6 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 3-nitro-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]hexanedioic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(CCC(=O)O)(CC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C25H39NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-25(26(31)32,22-24(29)30)21-19-23(27)28/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-22H2,1H3,(H,27,28)(H,29,30)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | JPVZTXGBBMHBPJ-DOFZRALJSA-N |
| XLogP | 6.49 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|