C21H25N3O4 — CID 59068445
2-methyl-N-[3-[(4-methylphenyl)methylamino]-1-(2-nitrophenyl)-3-oxopropyl]propan(15N)amide (PubChem CID 59068445) has the molecular formula C21H25N3O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-methyl-N-[3-[(4-methylphenyl)methylamino]-1-(2-nitrophenyl)-3-oxopropyl]propan(15N)amide.
| Compound Name | 2-methyl-N-[3-[(4-methylphenyl)methylamino]-1-(2-nitrophenyl)-3-oxopropyl]propan(15N)amide |
|---|---|
| PubChem CID | 59068445 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-methyl-N-[3-[(4-methylphenyl)methylamino]-1-(2-nitrophenyl)-3-oxopropyl]propan(15N)amide |
| SMILES | Cc1ccc(CNC(=O)CC([15NH]C(=O)C(C)C)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-14(2)21(26)23-18(17-6-4-5-7-19(17)24(27)28)12-20(25)22-13-16-10-8-15(3)9-11-16/h4-11,14,18H,12-13H2,1-3H3,(H,22,25)(H,23,26)/i23+1 |
| InChIKey | BWXJUIONFLXPGM-VSBQSISVSA-N |
| XLogP | 3.42 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|