C16H12F2INO — CID 59069446
(4R,5R)-2-(2,6-difluorophenyl)-4-(4-iodophenyl)-5-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 59069446) has the molecular formula C16H12F2INO and a molecular weight of 399.18 g/mol. Its IUPAC name is (4R,5R)-2-(2,6-difluorophenyl)-4-(4-iodophenyl)-5-methyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5R)-2-(2,6-difluorophenyl)-4-(4-iodophenyl)-5-methyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 59069446 |
| Molecular Formula | C16H12F2INO |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | (4R,5R)-2-(2,6-difluorophenyl)-4-(4-iodophenyl)-5-methyl-4,5-dihydro-1,3-oxazole |
| SMILES | C[C@H]1OC(c2c(F)cccc2F)=N[C@@H]1c1ccc(I)cc1 |
| InChI | InChI=1S/C16H12F2INO/c1-9-15(10-5-7-11(19)8-6-10)20-16(21-9)14-12(17)3-2-4-13(14)18/h2-9,15H,1H3/t9-,15+/m1/s1 |
| InChIKey | JQPRVHRULASKTG-PSLIRLAXSA-N |
| XLogP | 4.48 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|