C7H14N2O3 — CID 59072537
(3R,4S)-4-(methoxymethylamino)oxolane-3-carboxamide (PubChem CID 59072537) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is (3R,4S)-4-(methoxymethylamino)oxolane-3-carboxamide.
| Compound Name | (3R,4S)-4-(methoxymethylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 59072537 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (3R,4S)-4-(methoxymethylamino)oxolane-3-carboxamide |
| SMILES | COCN[C@@H]1COC[C@@H]1C(N)=O |
| InChI | InChI=1S/C7H14N2O3/c1-11-4-9-6-3-12-2-5(6)7(8)10/h5-6,9H,2-4H2,1H3,(H2,8,10)/t5-,6+/m0/s1 |
| InChIKey | OEUFGLZYCDDARC-NTSWFWBYSA-N |
| XLogP | -1.32 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|