C17H23N4O3W- — CID 59072832
1-[2-[(Z)-2-acetamido-3-oxobut-1-enyl]-5-carbamimidoylphenoxy]propan-2-yl-methylazanide;tungsten (PubChem CID 59072832) has the molecular formula C17H23N4O3W- and a molecular weight of 515.24 g/mol. Its IUPAC name is 1-[2-[(Z)-2-acetamido-3-oxobut-1-enyl]-5-carbamimidoylphenoxy]propan-2-yl-methylazanide;tungsten.
| Compound Name | 1-[2-[(Z)-2-acetamido-3-oxobut-1-enyl]-5-carbamimidoylphenoxy]propan-2-yl-methylazanide;tungsten |
|---|---|
| PubChem CID | 59072832 |
| Molecular Formula | C17H23N4O3W- |
| Molecular Weight | 515.24 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 1-[2-[(Z)-2-acetamido-3-oxobut-1-enyl]-5-carbamimidoylphenoxy]propan-2-yl-methylazanide;tungsten |
| SMILES | [H]/N=C(\N)c1ccc(/C=C(\NC(C)=O)C(C)=O)c(OCC(C)[N-]C)c1.[W] |
| InChI | InChI=1S/C17H23N4O3.W/c1-10(20-4)9-24-16-8-14(17(18)19)6-5-13(16)7-15(11(2)22)21-12(3)23;/h5-8,10H,9H2,1-4H3,(H3,18,19)(H,21,23);/q-1;/b15-7-; |
| InChIKey | WBXLMOPCFUFIMK-DFPPEFKWSA-N |
| XLogP | 1.80 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|