C17H24N4O3 — CID 59072833
N-[(Z)-1-[4-carbamimidoyl-2-[2-(methylamino)propoxy]phenyl]-3-oxobut-1-en-2-yl]acetamide (PubChem CID 59072833) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[(Z)-1-[4-carbamimidoyl-2-[2-(methylamino)propoxy]phenyl]-3-oxobut-1-en-2-yl]acetamide.
| Compound Name | N-[(Z)-1-[4-carbamimidoyl-2-[2-(methylamino)propoxy]phenyl]-3-oxobut-1-en-2-yl]acetamide |
|---|---|
| PubChem CID | 59072833 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-[(Z)-1-[4-carbamimidoyl-2-[2-(methylamino)propoxy]phenyl]-3-oxobut-1-en-2-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(/C=C(\NC(C)=O)C(C)=O)c(OCC(C)NC)c1 |
| InChI | InChI=1S/C17H24N4O3/c1-10(20-4)9-24-16-8-14(17(18)19)6-5-13(16)7-15(11(2)22)21-12(3)23/h5-8,10,20H,9H2,1-4H3,(H3,18,19)(H,21,23)/b15-7- |
| InChIKey | HVEQSTQHURYSGM-CHHVJCJISA-N |
| XLogP | 1.02 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|