About 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane
1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane (PubChem CID 59073306) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane.
Analyze 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane?
The IUPAC name of 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane (CID 59073306) is 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane.
What is the SMILES notation for 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane?
The canonical SMILES for 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane is CCCC1(CC)CC(C)(CC)C1(C)CC.
What is the InChIKey of 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane?
The InChIKey is OSLQYLRDXSWGMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-7-11-15(10-4)12-13(5,8-2)14(15,6)9-3/h7-12H2,1-6H3.
What are the key properties of 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane?
1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane has a molecular weight of 210.40 g/mol, XLogP of 5.42, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-triethyl-1,2-dimethyl-3-propylcyclobutane is sourced from PubChem (CID 59073306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).