C11H11NO3 — CID 59074546
5-methoxy-2,3-dimethyl-1H-indole-4,7-dione (PubChem CID 59074546) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 5-methoxy-2,3-dimethyl-1H-indole-4,7-dione.
| Compound Name | 5-methoxy-2,3-dimethyl-1H-indole-4,7-dione |
|---|---|
| PubChem CID | 59074546 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-methoxy-2,3-dimethyl-1H-indole-4,7-dione |
| SMILES | COC1=CC(=O)c2[nH]c(C)c(C)c2C1=O |
| InChI | InChI=1S/C11H11NO3/c1-5-6(2)12-10-7(13)4-8(15-3)11(14)9(5)10/h4,12H,1-3H3 |
| InChIKey | XAEHZQBWQYDHDA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|