C8H14BNO3 — CID 59074761
(3S)-2-[hydroxy(methyl)boranyl]-2-azabicyclo[2.2.1]heptane-3-carboxylic acid (PubChem CID 59074761) has the molecular formula C8H14BNO3 and a molecular weight of 183.02 g/mol. Its IUPAC name is (3S)-2-[hydroxy(methyl)boranyl]-2-azabicyclo[2.2.1]heptane-3-carboxylic acid.
| Compound Name | (3S)-2-[hydroxy(methyl)boranyl]-2-azabicyclo[2.2.1]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 59074761 |
| Molecular Formula | C8H14BNO3 |
| Molecular Weight | 183.02 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (3S)-2-[hydroxy(methyl)boranyl]-2-azabicyclo[2.2.1]heptane-3-carboxylic acid |
| SMILES | CB(O)N1C2CCC(C2)[C@H]1C(=O)O |
| InChI | InChI=1S/C8H14BNO3/c1-9(13)10-6-3-2-5(4-6)7(10)8(11)12/h5-7,13H,2-4H2,1H3,(H,11,12)/t5?,6?,7-/m0/s1 |
| InChIKey | VRYKSQJGDBNRHP-AHXFUIDQSA-N |
| XLogP | 0.03 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.02 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|