C9H18BFN2O — CID 167368971
[(2S,3S)-2-fluoro-3-(methylamino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid (PubChem CID 167368971) has the molecular formula C9H18BFN2O and a molecular weight of 200.07 g/mol. Its IUPAC name is [(2S,3S)-2-fluoro-3-(methylamino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid.
| Compound Name | [(2S,3S)-2-fluoro-3-(methylamino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
|---|---|
| PubChem CID | 167368971 |
| Molecular Formula | C9H18BFN2O |
| Molecular Weight | 200.07 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | [(2S,3S)-2-fluoro-3-(methylamino)-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
| SMILES | CN[C@H]1CC2CCC([C@H]1F)N2B(C)O |
| InChI | InChI=1S/C9H18BFN2O/c1-10(14)13-6-3-4-8(13)9(11)7(5-6)12-2/h6-9,12,14H,3-5H2,1-2H3/t6?,7-,8?,9-/m0/s1 |
| InChIKey | ZJILJHOXTMFLNP-QKZHKQSRSA-N |
| XLogP | 0.26 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.07 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|