C10H18BFN2O — CID 167369066
[(2S)-2-fluoro-3-methylimino-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid (PubChem CID 167369066) has the molecular formula C10H18BFN2O and a molecular weight of 212.08 g/mol. Its IUPAC name is [(2S)-2-fluoro-3-methylimino-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid.
| Compound Name | [(2S)-2-fluoro-3-methylimino-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid |
|---|---|
| PubChem CID | 167369066 |
| Molecular Formula | C10H18BFN2O |
| Molecular Weight | 212.08 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | [(2S)-2-fluoro-3-methylimino-9-azabicyclo[3.3.1]nonan-9-yl]-methylborinic acid |
| SMILES | C/N=C1\CC2CCCC([C@@H]1F)N2B(C)O |
| InChI | InChI=1S/C10H18BFN2O/c1-11(15)14-7-4-3-5-9(14)10(12)8(6-7)13-2/h7,9-10,15H,3-6H2,1-2H3/b13-8+/t7?,9?,10-/m1/s1 |
| InChIKey | RVGNDFZISGKJGG-JRYOAMKZSA-N |
| XLogP | 1.13 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.08 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|